|
CAS#: 24670-15-3 Product: Mercury Nitrate No suppilers available for the product. |
| Name | Mercury Nitrate |
|---|---|
| Synonyms | Mercuric Dinitrate; Citrine Ointment |
| Molecular Structure | ![]() |
| Molecular Formula | HgN2O6 |
| Molecular Weight | 324.60 |
| CAS Registry Number | 24670-15-3 |
| EINECS | 233-152-3 |
| SMILES | O=[N+]([O-])[O-].O=[N+]([O-])[O-].[Hg++] |
| InChI | 1S/Hg.2NO3/c;2*2-1(3)4/q+2;2*-1 |
| InChIKey | ORMNPSYMZOGSSV-UHFFFAOYSA-N |
| Boiling point | 83°C at 760 mmHg (Cal.) |
|---|---|
| (1) | In-Hyeok Park, Ki-Min Park and Shim Sung Lee. Preparation and characterisation of divalent hard and soft metal (M = Ca, Co, Cu, Zn, Cd, Hg and Pb) complexes of 1,10-dithia-18-crown-6: structural versatility, Dalton Trans., 2010, 39, 9696. |
|---|---|
| Market Analysis Reports |