|
CAS#: 2483-51-4 Product: Methyl N-[(Benzyloxy)Carbonyl]-L-Alanyl-L-Alaninate No suppilers available for the product. |
| Name | Methyl N-[(Benzyloxy)Carbonyl]-L-Alanyl-L-Alaninate |
|---|---|
| Synonyms | Z-ALA-ALA-OME; Z-L-Ala-L-Ala-OMe; ZINC02556671 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 |
| CAS Registry Number | 2483-51-4 |
| SMILES | C[C@@H](C(=O)N[C@@H](C)C(=O)OC)NC(=O)OCC1=CC=CC=C1 |
| InChI | 1S/C15H20N2O5/c1-10(13(18)16-11(2)14(19)21-3)17-15(20)22-9-12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3,(H,16,18)(H,17,20)/t10-,11-/m0/s1 |
| InChIKey | CUCAZZQPISJXOS-QWRGUYRKSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 497.7±35.0°C at 760 mmHg (Cal.) |
| Flash point | 254.8±25.9°C (Cal.) |
| Refractive index | 1.518 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Roger R. Hill, David Birch, Graham E. Jeffs and Michael North. Enantioselection in peptide bond formation, Org. Biomol. Chem., 2003, 1, 965. |
|---|---|
| Market Analysis Reports |