| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Name | (4-Nitrophenyl)-Phenyldiazene |
|---|---|
| Synonyms | (4-Nitrophenyl)-Phenyl-Diazene; Diazene, (4-Nitrophenyl)Phenyl- (9Ci) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9N3O2 |
| Molecular Weight | 227.22 |
| CAS Registry Number | 2491-52-3 |
| EINECS | 219-656-6 |
| SMILES | C1=CC(=CC=C1)N=NC2=CC=C(C=C2)[N+]([O-])=O |
| InChI | 1S/C12H9N3O2/c16-15(17)12-8-6-11(7-9-12)14-13-10-4-2-1-3-5-10/h1-9H |
| InChIKey | TZTDJBMGPQLSLI-UHFFFAOYSA-N |
| Density | 1.238g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.895°C at 760 mmHg (Cal.) |
| Flash point | 191.416°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Ping Xie and Rongben Zhang. Liquid crystal elastomers, networks and gels: advanced smart materials, J. Mater. Chem., 2005, 15, 2529. |
|---|---|
| Market Analysis Reports |