| Apollo Scientific Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (161) 406-0505 | |||
![]() |
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| City Chemical LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (203) 932-2489 | |||
![]() |
sales@citychemical.com | |||
| Chemical distributor | ||||
| ProChem, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (815) 398-1788 | |||
![]() |
prochem3@aol.com | |||
| Chemical manufacturer since 1986 | ||||
| Classification | Organic raw materials >> Carboxylic compounds and derivatives >> Salt of carboxylic acid ester and its derivatives |
|---|---|
| Name | Ethanedioic Acid Praseodymium Salt, Hydrate (3:2:10) |
| Synonyms | Praseodymium Oxalate Decahydrate 99.9%; PRASEODYMIUM(III) OXALATE DECAHYDRATE; Praseodymium(Ⅲ) Oxalate N-Hydrate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H2O12 |
| Molecular Weight | 290.09 |
| CAS Registry Number | 24992-60-7 |
| SMILES | O=C(C(=O)OC1OC(=O)C(=O)O1)OC1OC(=O)C(=O)O1 |
| InChI | 1S/C8H2O12/c9-1-2(10)16-7(15-1)19-5(13)6(14)20-8-17-3(11)4(12)18-8/h7-8H |
| SDS | Available |
|---|---|
| Market Analysis Reports |