|
CAS#: 25034-71-3 Product: 3alpha,4,7,7alpha-Tetrahydro-4,7-Methano-1H-Indene Polymer With Ethene And 1-Propene No suppilers available for the product. |
| Name | 3alpha,4,7,7alpha-Tetrahydro-4,7-Methano-1H-Indene Polymer With Ethene And 1-Propene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 |
| CAS Registry Number | 25034-71-3 |
| SMILES | C3C1C(C2CC1C=C2)C=C3.CC=C.C=C |
| InChI | 1S/C10H12.C3H6.C2H4/c1-2-9-7-4-5-8(6-7)10(9)3-1;1-3-2;1-2/h1-2,4-5,7-10H,3,6H2;3H,1H2,2H3;1-2H2 |
| InChIKey | FONZLIJOWFDKNC-UHFFFAOYSA-N |
| Boiling point | 170°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 46.8°C (Cal.) |
| Market Analysis Reports |