|
CAS#: 25053-48-9 Product: 2-Ethenyl-Pyridine Polymer With 1,3-Butadiene And Ethenylbenzene No suppilers available for the product. |
| Name | 2-Ethenyl-Pyridine Polymer With 1,3-Butadiene And Ethenylbenzene |
|---|---|
| Synonyms | Buta-1,3-Diene; Styrene; 2-Vinylpyridine; Buta-1,3-Diene; Ethenylbenzene; 2-Ethenylpyridine |
| Molecular Structure | ![]() |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 |
| CAS Registry Number | 25053-48-9 |
| SMILES | C1=CC=CN=C1C=C.C2=C(C=CC=C2)C=C.C(C=C)=C |
| InChI | 1S/C8H8.C7H7N.C4H6/c1-2-8-6-4-3-5-7-8;1-2-7-5-3-4-6-8-7;1-3-4-2/h2-7H,1H2;2-6H,1H2;3-4H,1-2H2 |
| InChIKey | QUEICCDHEFTIQD-UHFFFAOYSA-N |
| Boiling point | 145.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 31.1°C (Cal.) |
| Market Analysis Reports |