| Snieckus Innovations | Canada | |||
|---|---|---|---|---|
![]() |
+1 (613) 537-5472 | |||
![]() |
info@snieckusinnovations.ca | |||
| Chemical manufacturer | ||||
| Name | Diethyl Phenyl Phosphate |
|---|---|
| Synonyms | Phosphoric Acid Diethyl Phenyl Ester; Ai3-19536; Nsc 171165 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15O4P |
| Molecular Weight | 230.20 |
| CAS Registry Number | 2510-86-3 |
| SMILES | C1=CC(=CC=C1)O[P](OCC)(OCC)=O |
| InChI | 1S/C10H15O4P/c1-3-12-15(11,13-4-2)14-10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | DHTQKXHLXVUBCF-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.652°C at 760 mmHg (Cal.) |
| Flash point | 127.877°C (Cal.) |
| (1) | Josephine S. W. Tsang, Alexei A. Neverov and R. S. Brown. La-catalyzed methanolysis of O,O-diethyl S-(p-nitrophenyl) phosphorothioate and O,O-diethyl S-phenyl phosphorothioate. Millions-fold acceleration of the destruction of V-agent simulants, Org. Biomol. Chem., 2004, 2, 3457. |
|---|---|
| Market Analysis Reports |