| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Diethylene glycol dimethacrylate homopolymer |
|---|---|
| Synonyms | 2-Methylprop-2-Enoic Acid 2-[2-(2-Methyl-1-Oxoprop-2-Enoxy)Ethoxy]Ethyl Ester; 2-Methylacrylic Acid 2-(2-Methacryloyloxyethoxy)Ethyl Ester; Dgm 2 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 25101-18-2 |
| SMILES | C(OC(C(C)=C)=O)COCCOC(C(C)=C)=O |
| InChI | 1S/C12H18O5/c1-9(2)11(13)16-7-5-15-6-8-17-12(14)10(3)4/h1,3,5-8H2,2,4H3 |
| InChIKey | XFCMNSHQOZQILR-UHFFFAOYSA-N |
| Density | 1.055g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.77°C at 760 mmHg (Cal.) |
| Flash point | 138.748°C (Cal.) |
| (1) | Daniel Wenzlik, Christian Ohm, Christophe Serra and Rudolf Zentel. Preparation of cholesteric particles from cellulose derivatives in a microfluidic setup, Soft Matter, 2011, 7, 2340. |
|---|---|
| Market Analysis Reports |