| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Rieke Metals, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (402) 434-2775 | |||
![]() |
sales@riekemetals.com | |||
| Chemical manufacturer | ||||
| Name | (3-Iodophenyl)(Phenyl)Methanone |
|---|---|
| Synonyms | InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9IO |
| Molecular Weight | 308.11 |
| CAS Registry Number | 25116-37-4 |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)I |
| InChI | 1S/C13H9IO/c14-12-8-4-7-11(9-12)13(15)10-5-2-1-3-6-10/h1-9H |
| InChIKey | JAFDVXCJWWEVND-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 379.9±25.0°C at 760 mmHg (Cal.) |
| Flash point | 183.6±23.2°C (Cal.) |
| Refractive index | 1.648 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Hervé J. C. Deboves, Christian A. G. N. Montalbetti and Richard F. W. Jackson. Direct synthesis of Fmoc-protected amino acids using organozinc chemistry: application to polymethoxylated phenylalanines and 4-oxoamino acids, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 1876. |
|---|---|
| Market Analysis Reports |