| Allbiosyn Biotechnology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.allbiosyn.com | |||
![]() | +86 15900695956 | |||
![]() | info@allbiosyn.com | |||
![]() | WeChat: 15900695956 | |||
![]() | WhatsApp:86 15900695956 | |||
| Chemical manufacturer since 2023 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Organic raw materials >> Aryl compounds |
|---|---|
| Name | N-(9-((2R,3R,4R,5R)-5-((Bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxy-3-(2-methoxyethoxy)tetrahydrofuran-2-yl)-6-oxo-6,9-dihydro-1H-purin-2-yl)isobutyramide |
| Synonyms | 5'-O-[Bis(4-methoxyphenyl)(phenyl)methyl]-N-isobutyryl-2'-O-(2-methoxyethyl)guanosine |
| Molecular Structure | ![]() |
| Molecular Formula | C38H43N5O9 |
| Molecular Weight | 713.78 |
| CAS Registry Number | 251647-50-4 |
| SMILES | CC(C)C(=O)NC1=NC2=C(C(=O)N1)N=CN2[C@H]3[C@@H]([C@@H]([C@H](O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O)OCCOC |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 Details |
| SDS | Available |
|
N-(9-((2R,3R,4R,5R)-5-((bis(4-methoxyphenyl)(phenyl)methoxy)methyl)-4-hydroxy-3-(2-methoxyethoxy)tetrahydrofuran-2-yl)-6-oxo-6,9-dihydro-1H-purin-2-yl)isobutyramide (referred to as Compound X) is a complex synthetic molecule with great potential in chemical and pharmaceutical research. The synthesis of Compound X is part of an effort to create novel nucleoside derivatives with enhanced biological activity and stability. The structure combines a purine base with a tetrahydrofuran ring and an isobutyramide group, each of which contributes to the unique properties of the molecule. The synthesis involves multiple steps, including functionalization of the purine core and introduction of various substituents on the tetrahydrofuran ring. The synthesis of compound X involves several stages: the purine core is modified to include a 6-oxo group and a connection to a tetrahydrofuran ring; the tetrahydrofuran ring is substituted with multiple functional groups, including methoxyethyl and bis(4-methoxyphenyl)(phenyl)methoxy; and finally assembled, the isobutylamide moiety is attached to complete the synthesis of the compound. This multi-step synthesis ensures the selective introduction of functional groups, resulting in a highly specific and complex molecule. Compound X has attracted attention from various fields due to its complex structure and potential biological activities: As a nucleoside analog, compound X has been studied for its potential as an antiviral or anticancer agent. Its unique structure could enhance its interaction with biological targets, potentially leading to new therapeutic options. The stability and biological activity of this molecule make it a candidate for development into a drug. Researchers explore its efficacy in preclinical models to evaluate its potential as a treatment for various diseases. In addition to its therapeutic potential, compound X is also a valuable tool in chemical research. Its complex structure helps scientists understand the interaction between nucleosides and their targets, providing insights into the chemistry and function of nucleosides. References 2003. Process Development for the Synthesis of 5′-O-(4,4′-Dimethoxytrityl)-N2-isobutyryl-2′-O-(2-methoxyethyl)-guanosine—A Potential Precursor for the Second Generation Antisense Oligonucleotides: An Improved Process for the Preparation of 2′-O-Alkyl-2,6-diaminopurine Riboside. Nucleosides, Nucleotides and Nucleic Acids, 22(10). DOI: 10.1081/ncn-120022957 |
| Market Analysis Reports |