| APIChem Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (571) 8678-2096 | |||
![]() |
sales@apichemistry.com | |||
| Chemical manufacturer since 2009 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| ZereneX Molecular Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1204) 527-700 | |||
![]() |
sales@zerenex-molecular.com | |||
| Chemical manufacturer | ||||
| Name | Polyvinylcaprolactam |
|---|---|
| Synonyms | 1-Vinyl-2-Azepanone; 1-Vinylazepan-2-One; Inchi=1/C8h13no/C1-2-9-7-5-3-4-6-8(9)10/H2h,1,3-7H |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 |
| CAS Registry Number | 25189-83-7 |
| SMILES | O=C1N(CCCCC1)C=C |
| InChI | 1S/C8H13NO/c1-2-9-7-5-3-4-6-8(9)10/h2H,1,3-7H2 |
| InChIKey | JWYVGKFDLWWQJX-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 1.029 (Expl.) | |
| Melting point | 36°C (Expl.) |
| Boiling point | 128°C (Expl.) |
| 254.7±7.0°C at 760 mmHg (Cal.) | |
| Flash point | 101°C (Expl.) |
| 112.5±9.4°C (Cal.) | |
| Safety Code | S26;S37 Details |
|---|---|
| Risk Code | R36/37/38 Details |
| Hazard Symbol | X Details |
| Safety Description | WARNING: Irritates skin and eyes, harmful if swallowed |
| Safety glasses, adequate ventilation. | |
| (1) | Jose Ramos, Ainara Imaz, José Callejas-Fernández, Lucyanna Barbosa-Barros, Joan Estelrich, Manuel Quesada-Pérez and Jacqueline Forcada. Soft nanoparticles (thermo-responsive nanogels and bicelles) with biotechnological applications: from synthesis to simulation through colloidal characterization, Soft Matter, 2011, 7, 5067. |
|---|---|
| Market Analysis Reports |