| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1,1,2,3,3,3-Hexafluoro-1-Propene Polymer With 1,1-Difluoroethene And Tetrafluoroethene |
|---|---|
| Synonyms | 1,1-Difluoroethylene; 1,1,2,3,3,3-Hexafluoroprop-1-Ene; 1,1,2,2-Tetrafluoroethylene; 1-Propene, 1,1,2,3,3,3-Hexafluoro-, Polymer With 1,1-Difluoroetheneand Tetrafluoroethene; 1,1-Difluoroethene, Tetrafluoroethene, 1,1,2,3,3,3-Hexafluoro-1-Propene Polymer |
| Molecular Structure | ![]() |
| Molecular Formula | C7H2F12 |
| Molecular Weight | 314.07 |
| CAS Registry Number | 25190-89-0 |
| SMILES | C(F)(C(F)(F)F)=C(F)F.C(F)(F)=C(F)F.C(F)(F)=C |
| InChI | 1S/C3F6.C2F4.C2H2F2/c4-1(2(5)6)3(7,8)9;3-1(4)2(5)6;1-2(3)4/h;;1H2 |
| InChIKey | XHGMOUXCWNPJHF-UHFFFAOYSA-N |
| Market Analysis Reports |