| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | 2-Phenyl-1,2-Benzothiazol-3-One |
|---|---|
| Synonyms | Rp 62373; 2-Phenyl-1,2-Benzisothiazol-3-(2H)-One; 2-Phenyl-1,2-Benzoisothiazol-3(2H)-One |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9NOS |
| Molecular Weight | 227.28 |
| CAS Registry Number | 2527-03-9 |
| SMILES | C1=CC=CC2=C1C(=O)N(S2)C3=CC=CC=C3 |
| InChI | 1S/C13H9NOS/c15-13-11-8-4-5-9-12(11)16-14(13)10-6-2-1-3-7-10/h1-9H |
| InChIKey | KDMQSUUXKLZVNU-UHFFFAOYSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.857°C at 760 mmHg (Cal.) |
| Flash point | 188.974°C (Cal.) |
| (1) | Yumiao Han, Qun Luo, Xiang Hao, Xianchan Li, Fuyi Wang, Wenbing Hu, Kui Wu, Shuang Lü and Peter J. Sadler. Reactions of an organoruthenium anticancer complex with 2-mercaptobenzanilide—a model for the active-site cysteine of protein tyrosine phosphatase 1B, Dalton Trans., 2011, 40, 11519. |
|---|---|
| Market Analysis Reports |