|
CAS#: 25494-44-4 Product: (3R,3'S,5'R,6'S)-5',6'-Dihydro-5',6'-Epoxy-beta,beta-Carotene-3,3'-Diol No suppilers available for the product. |
| Name | (3R,3'S,5'R,6'S)-5',6'-Dihydro-5',6'-Epoxy-beta,beta-Carotene-3,3'-Diol |
|---|---|
| Synonyms | 5,6-epoxy-5,6-dihydro-β,β-carotene-3,3'-diol; β,β-Carotene-3,3'-diol, 5,6-epoxy-5,6-dihydro- (VAN); C08579 |
| Molecular Structure | ![]() |
| Molecular Formula | C40H56O3 |
| Molecular Weight | 584.87 |
| CAS Registry Number | 25494-44-4 |
| SMILES | CC1=C(C(C[C@@H](C1)O)(C)C)/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/[C@]23[C@](O2)(C[C@H](CC3(C)C)O)C)/C)/C |
| InChI | 1S/C40H56O3/c1-29(17-13-19-31(3)21-22-36-33(5)25-34(41)26-37(36,6)7)15-11-12-16-30(2)18-14-20-32(4)23-24-40-38(8,9)27-35(42)28-39(40,10)43-40/h11-24,34-35,41-42H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,22-21+,24-23+,29-15+,30-16+,31-19+,32-20+/t34-,35+,39-,40+/m1/s1 |
| InChIKey | OFNSUWBAQRCHAV-OYQUVCAXSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 708.6±60.0°C at 760 mmHg (Cal.) |
| Flash point | 382.4±32.9°C (Cal.) |
| Refractive index | 1.598 (Cal.) |
| (1) | Andreas Dreuw, Graham R. Fleming and Martin Head-Gordon. Chlorophyll fluorescence quenching by xanthophylls, Phys. Chem. Chem. Phys., 2003, 5, 3247. |
|---|---|
| Market Analysis Reports |