|
CAS#: 25548-02-1 Product: 4,4,7A-Trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-1,5,10,14-Tetramethyl-16-(2,2,6-Trimethylcyclohexylidene)Hexadeca-1,3,5,7,9,11,13,15-Octaenyl]-2,5,6,7-Tetrahydrobenzofuran No suppilers available for the product. |
| Name | 4,4,7A-Trimethyl-2-[(1E,3E,5E,7E,9E,11E,13E)-1,5,10,14-Tetramethyl-16-(2,2,6-Trimethylcyclohexylidene)Hexadeca-1,3,5,7,9,11,13,15-Octaenyl]-2,5,6,7-Tetrahydrobenzofuran |
|---|---|
| Synonyms | neochrome |
| Molecular Structure | ![]() |
| Molecular Formula | C40H56O |
| Molecular Weight | 552.87 |
| CAS Registry Number | 25548-02-1 |
| SMILES | CC/3CCCC(C)(C)C\3=C=CC(\C)=C\C=C\C(\C)=C\C=C\C=C(/C)\C=C\C=C(/C)C1\C=C2\C(C)(C)CCCC2(C)O1 |
| InChI | 1S/C40H56O/c1-30(19-13-20-32(3)24-25-35-33(4)23-15-26-38(35,6)7)17-11-12-18-31(2)21-14-22-34(5)36-29-37-39(8,9)27-16-28-40(37,10)41-36/h11-14,17-22,24,29,33,36H,15-16,23,26-28H2,1-10H3/b12-11+,19-13+,21-14+,30-17+,31-18+,32-20+,34-22+ |
| InChIKey | VZYSSTUDRDLCSC-NEFHIMGMSA-N |
| Density | 0.968g/cm3 (Cal.) |
|---|---|
| Boiling point | 655.559°C at 760 mmHg (Cal.) |
| Flash point | 320.197°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| (1) | Tsai-Hua Kao, Chia-Ju Chen and Bing-Huei Chen. Carotenoid composition in Rhinacanthus nasutus (L.) Kurz as determined by HPLC-MS and affected by freeze-drying and hot-air-drying, Analyst, 2011, 136, 3194. |
|---|---|
| Market Analysis Reports |