| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Atlantic Research Chemicals Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (8707) 746-454 | |||
![]() |
info@atlantic-chemicals.com | |||
| Chemical manufacturer | ||||
| Atomax Chemicals Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 13417589054/ | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | Oxo(Phenyl)Acetyl Chloride |
|---|---|
| Synonyms | 2-Oxo-2-phenylacetyl chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C8H5ClO2 |
| Molecular Weight | 168.58 |
| CAS Registry Number | 25726-04-9 |
| SMILES | C1=CC=C(C=C1)C(=O)C(=O)Cl |
| InChI | 1S/C8H5ClO2/c9-8(11)7(10)6-4-2-1-3-5-6/h1-5H |
| InChIKey | BNGOFPJWZUXKNR-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.7±23.0°C at 760 mmHg (Cal.) |
| Flash point | 109.4±23.2°C (Cal.) |
| Refractive index | 1.549 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Frances Heaney, Julie Fenlon, Patrick McArdle and Desmond Cunningham. a-Keto amides as precursors to heterocycles—generation and cycloaddition reactions of piperazin-5-one nitrones, Org. Biomol. Chem., 2003, 1, 1122. |
|---|---|
| Market Analysis Reports |