| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Alfa Pyridines | USA | |||
|---|---|---|---|---|
![]() |
+1 (609) 447-3255 | |||
![]() |
sales@pyridines.info | |||
| Chemical manufacturer | ||||
| Name | 5-Pyridin-3-Yl-[1,3,4]Oxathiazol-2-One |
|---|---|
| Synonyms | 5-(3-Pyridyl)-1,3,4-Oxathiazol-2-One; 1,3,4-Oxathiazol-2-One, 5-(3-Pyridinyl)-; Aids-004221 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H4N2O2S |
| Molecular Weight | 180.18 |
| CAS Registry Number | 257286-36-5 |
| SMILES | C2=C(C1=NSC(O1)=O)C=CC=N2 |
| InChI | 1S/C7H4N2O2S/c10-7-11-6(9-12-7)5-2-1-3-8-4-5/h1-4H |
| InChIKey | UBPOITHMKKOZFC-UHFFFAOYSA-N |
| Density | 1.555g/cm3 (Cal.) |
|---|---|
| Boiling point | 302.074°C at 760 mmHg (Cal.) |
| Flash point | 136.49°C (Cal.) |
| (1) | Philip Prathipati, Ngai Ling Ma* and Thomas H. Keller. Global Bayesian Models for the Prioritization of Antitubercular Agents, J. Chem. Inf. Model., 2008, 48 (12), pp 2362–2370 |
|---|---|
| Market Analysis Reports |