| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 1,8-Dihydropteridine-2,4,7-Trione |
|---|---|
| Synonyms | 2,4,7(1H,3H,8H)-Pteridinetrione; Nsc405591; 2,4,6-Trihydroxypteridine |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4N4O3 |
| Molecular Weight | 180.12 |
| CAS Registry Number | 2577-38-0 |
| SMILES | O=C1C2=C(NC(N1)=O)NC(C=N2)=O |
| InChI | 1S/C6H4N4O3/c11-2-1-7-3-4(8-2)9-6(13)10-5(3)12/h1H,(H3,8,9,10,11,12,13) |
| InChIKey | BCVUYVOMXUKYFC-UHFFFAOYSA-N |
| Density | 2.175g/cm3 (Cal.) |
|---|---|
| Boiling point | 742.5°C at 760 mmHg (Cal.) |
| Flash point | 402.9°C (Cal.) |
| (1) | MERLINI L, NASINI G. Insect pigments—IV. Pteridines and colour in some Hemiptera☆, Journal of Insect Physiology, 1966 |
|---|---|
| Market Analysis Reports |