| ChemBridge Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-7400 | |||
![]() |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | Phenyl(2-Thienyl)Methanol |
|---|---|
| Synonyms | InChI=1/C |
| Molecular Structure | ![]() |
| Molecular Formula | C11H10OS |
| Molecular Weight | 190.26 |
| CAS Registry Number | 26059-21-2 |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CS2)O |
| InChI | 1S/C11H10OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8,11-12H |
| InChIKey | AASDNBSTNIJBFZ-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.1±27.0°C at 760 mmHg (Cal.) |
| Flash point | 154.1±23.7°C (Cal.) |
| Refractive index | 1.627 (Cal.) |
| (1) | Manabu Shilai, Yoshinori Kondo and Takao Sakamoto. Selective metallation of thiophene and thiazole rings with magnesium amide base, J. Chem. Soc., Perkin Trans. 1, 2001, 0, 442. |
|---|---|
| Market Analysis Reports |