| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Dyes and pigments >> Dyes >> Disperse dye |
|---|---|
| Name | 9H-Thioxanthene |
| Synonyms | Inchi=1/C13h10s/C1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/H1-8H,9H; 10H-Dibenzo(B,E)Thiin |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10S |
| Molecular Weight | 198.28 |
| CAS Registry Number | 261-31-4 |
| EINECS | 205-972-1 |
| SMILES | C1=CC=CC2=C1CC3=C(S2)C=CC=C3 |
| InChI | 1S/C13H10S/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-8H,9H2 |
| InChIKey | PQJUJGAVDBINPI-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.0±22.0°C at 760 mmHg (Cal.) |
| Flash point | 146.3±19.0°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Samia Amriou, Aravinda Mehta and Martin R. Bryce. Functionalised 9-(1,3-dithiol-2-ylidene)thioxanthene derivatives: a C conjugate as an ambipolar organic field effect transistor (OFET), J. Mater. Chem., 2005, 15, 1232. |
|---|---|
| Market Analysis Reports |