|
CAS#: 26353-67-3 Product: 2-Naphthalenesulfonic acid, polymer with formaldehyde No suppilers available for the product. |
| Name | 2-Naphthalenesulfonic acid, polymer with formaldehyde |
|---|---|
| Synonyms | Formaldehyde; 2-Naphthalenesulfonic Acid; Methanal; Naphthalene-2-Sulfonic Acid; 2-Naphthalenesulfonic Acid, Polymer With Formaldehyde |
| Molecular Formula | C11H10O4S |
| Molecular Weight | 238.26 |
| CAS Registry Number | 26353-67-3 |
| SMILES | O=C.C1=C2C(=CC=C1[S](=O)(=O)O)C=CC=C2 |
| InChI | 1S/C10H8O3S.CH2O/c11-14(12,13)10-6-5-8-3-1-2-4-9(8)7-10;1-2/h1-7H,(H,11,12,13);1H2 |
| InChIKey | RRDQTXGFURAKDI-UHFFFAOYSA-N |
| Boiling point | 488.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 249.2°C (Cal.) |
| Market Analysis Reports |