|
CAS#: 2652-78-0 Product: 4-Benzylidene-1,2-Diphenyl-Pyrazolidine-3,5-Dione No suppilers available for the product. |
| Name | 4-Benzylidene-1,2-Diphenyl-Pyrazolidine-3,5-Dione |
|---|---|
| Synonyms | 4-benzylidene-1,2-diphenyl-pyrazolidine-3,5-dione |
| Molecular Structure | ![]() |
| Molecular Formula | C22H16N2O2 |
| Molecular Weight | 340.38 |
| CAS Registry Number | 2652-78-0 |
| SMILES | c1ccc(cc1)C=C2C(=O)N(N(C2=O)c3ccccc3)c4ccccc4 |
| InChI | 1S/C22H16N2O2/c25-21-20(16-17-10-4-1-5-11-17)22(26)24(19-14-8-3-9-15-19)23(21)18-12-6-2-7-13-18/h1-16H |
| InChIKey | IPGOIMUBZKYHNY-UHFFFAOYSA-N |
| Density | 1.309g/cm3 (Cal.) |
|---|---|
| Boiling point | 493.779°C at 760 mmHg (Cal.) |
| Flash point | 215.367°C (Cal.) |
| Refractive index | 1.702 (Cal.) |
| (1) | Selva A, Citterio A, Merlini L. Mass Spectrometry of Heterocyclic compounds. VIII. Electron-impact-induced fragmentation of 1,2-diphenyl-pyrazolidine-3,5-dione and some 4-substituted derivatives, Organic Mass Spectrometry 1975, 10, 606-616 |
|---|---|
| Market Analysis Reports |