| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | (3,5-Ditert-Butylphenyl) N-Methylcarbamate |
|---|---|
| Synonyms | N-Methylcarbamic Acid (3,5-Ditert-Butylphenyl) Ester; 3,5-Bis(1,1-Dimethylethyl)Phenol Methylcarbamate; 3,5-Di-T-Butylphenylmethylcarbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 |
| CAS Registry Number | 2655-19-8 |
| SMILES | C1=C(C=C(C=C1C(C)(C)C)C(C)(C)C)OC(=O)NC |
| InChI | 1S/C16H25NO2/c1-15(2,3)11-8-12(16(4,5)6)10-13(9-11)19-14(18)17-7/h8-10H,1-7H3,(H,17,18) |
| InChIKey | SLZWBCGZQRRUNG-UHFFFAOYSA-N |
| Density | 0.978g/cm3 (Cal.) |
|---|---|
| Boiling point | 313.547°C at 760 mmHg (Cal.) |
| Flash point | 143.428°C (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |