| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 4-Butyl-4-Methyl-1,2-Diphenyl-3,5-Pyrazolidinedione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.40 |
| CAS Registry Number | 26598-82-3 |
| SMILES | O=C2N(c1ccccc1)N(C(=O)C2(C)CCCC)c3ccccc3 |
| InChI | 1S/C20H22N2O2/c1-3-4-15-20(2)18(23)21(16-11-7-5-8-12-16)22(19(20)24)17-13-9-6-10-14-17/h5-14H,3-4,15H2,1-2H3 |
| InChIKey | QBXQDSFAILUQAX-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.204°C at 760 mmHg (Cal.) |
| Flash point | 170.147°C (Cal.) |
| Refractive index | 1.577 (Cal.) |
| (1) | Selva A, Citterio A, Merlini L. Mass Spectrometry of Heterocyclic compounds. VIII. Electron-impact-induced fragmentation of 1,2-diphenyl-pyrazolidine-3,5-dione and some 4-substituted derivatives, Organic Mass Spectrometry 1975, 10, 606-616 |
|---|---|
| Market Analysis Reports |