| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Diaminotrinitrobenzene |
|---|---|
| Synonyms | (6-Amino-2,3,4-Trinitro-Phenyl)Amine; Diaminotrinitrobenzene |
| Molecular Structure | ![]() |
| Molecular Formula | C6H5N5O6 |
| Molecular Weight | 243.14 |
| CAS Registry Number | 26616-30-8 |
| EINECS | 247-847-4 |
| SMILES | C1=C([N+]([O-])=O)C(=C([N+]([O-])=O)C(=C1N)N)[N+]([O-])=O |
| InChI | 1S/C6H5N5O6/c7-2-1-3(9(12)13)5(10(14)15)6(4(2)8)11(16)17/h1H,7-8H2 |
| InChIKey | DWSHPNQTKZNJFW-UHFFFAOYSA-N |
| Density | 1.877g/cm3 (Cal.) |
|---|---|
| Boiling point | 638.652°C at 760 mmHg (Cal.) |
| Flash point | 340.045°C (Cal.) |
| (1) | Olivier Siri and Pierre Braunstein. Tuning the synthesis of a dinitroaromatic towards a new trinitroaromatic stabilized energetic material, New J. Chem., 2005, 29, 75. |
|---|---|
| Market Analysis Reports |