|
CAS#: 26620-71-3 Product: Aristolochene No suppilers available for the product. |
| Name | Aristolochene |
|---|---|
| Synonyms | (4R,4As,6R)-6-Isopropenyl-4,4A-Dimethyl-2,3,4,5,6,7-Hexahydro-1H-Naphthalene; (-)-Aristolochene; (1R,7R,8As)-Aristolochene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 26620-71-3 |
| SMILES | [C@]12(C[C@H](C(=C)C)CC=C1CCC[C@H]2C)C |
| InChI | 1S/C15H24/c1-11(2)13-8-9-14-7-5-6-12(3)15(14,4)10-13/h9,12-13H,1,5-8,10H2,2-4H3/t12-,13-,15+/m1/s1 |
| InChIKey | YONHOSLUBQJXPR-NFAWXSAZSA-N |
| Density | 0.894g/cm3 (Cal.) |
|---|---|
| Boiling point | 274.248°C at 760 mmHg (Cal.) |
| Flash point | 107.811°C (Cal.) |
| (1) | Melanie J. Calvert, Susan E. Taylor and Rudolf K. Allemann. Tyrosine 92 of aristolochene synthase directs cyclisation of farnesyl pyrophosphate, Chem. Commun., 2002, 0, 2384. |
|---|---|
| Market Analysis Reports |