|
CAS#: 26655-24-3 Product: 1,3-Isobenzofurandione, Polymer With 1,2,3-Propanetriol No suppilers available for the product. |
| Name | 1,3-Isobenzofurandione, Polymer With 1,2,3-Propanetriol |
|---|---|
| Synonyms | Glycerol; Isobenzofuran-1,3-Dione; Glycerol; Isobenzofuran-1,3-Quinone; 1,2,3-Propanetriol, 1,3-Isobenzofurandione Polymer |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 |
| CAS Registry Number | 26655-24-3 |
| SMILES | C1=CC=CC2=C1C(OC2=O)=O.C(O)C(O)CO |
| InChI | 1S/C8H4O3.C3H8O3/c9-7-5-3-1-2-4-6(5)8(10)11-7;4-1-3(6)2-5/h1-4H;3-6H,1-2H2 |
| InChIKey | QLEITUFVKZSFRB-UHFFFAOYSA-N |
| Boiling point | 295°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 139.7°C (Cal.) |
| Market Analysis Reports |