| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| ChemDiv, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 794-4860 | |||
![]() |
chemdiv@chemdiv.com | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4'-(Dimethylamino)Propiophenone |
|---|---|
| Synonyms | 1-Propanone, 1-(4-(Dimethylamino)Phenyl)- (9Ci); 4'-(Dimethylamino)Propiophenone; 4-(N,N-Dimethylamino)Propiophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 |
| CAS Registry Number | 26672-58-2 |
| SMILES | C1=C(N(C)C)C=CC(=C1)C(=O)CC |
| InChI | 1S/C11H15NO/c1-4-11(13)9-5-7-10(8-6-9)12(2)3/h5-8H,4H2,1-3H3 |
| InChIKey | ONCICIKBSHQJTB-UHFFFAOYSA-N |
| Density | 1.01g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.431°C at 760 mmHg (Cal.) |
| Flash point | 110.626°C (Cal.) |
| (1) | Helou Marion. Ruthenium-catalyzed tandem allylic substitution/isomerization: a direct route to propiophenones from cinnamyl chloride derivatives, New Journal of Chemistry, 2008 |
|---|---|
| Market Analysis Reports |