| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 4-(4-Chlorophenyl)Dihydrofuran-2(3H)-One |
|---|---|
| Synonyms | 4-(4-Chlorophenyl)Tetrahydrofuran-2-One; 4-(4-Chlorophenyl)-2-Tetrahydrofuranone; 4-(P-Chlorophenyl)Dihydrofuran-2(3H)-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9ClO2 |
| Molecular Weight | 196.63 |
| CAS Registry Number | 26717-54-4 |
| EINECS | 247-913-2 |
| SMILES | C2=C(C1CC(OC1)=O)C=CC(=C2)Cl |
| InChI | 1S/C10H9ClO2/c11-9-3-1-7(2-4-9)8-5-10(12)13-6-8/h1-4,8H,5-6H2 |
| InChIKey | FJIIHITUMSUKIQ-UHFFFAOYSA-N |
| Density | 1.29g/cm3 (Cal.) |
|---|---|
| Boiling point | 357.224°C at 760 mmHg (Cal.) |
| Flash point | 193.165°C (Cal.) |
| (1) | Niiha Sasakura, Keiji Nakano, Yoshiyasu Ichikawa and Hiyoshizo Kotsuki. A new environmentally friendly method for the Baeyer–Villiger oxidation of cyclobutanones catalyzed by thioureas using HO as an oxidant, RSC Advances, 2012, 2, 6135. |
|---|---|
| Market Analysis Reports |