| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Specs Ltd. | Netherlands | |||
|---|---|---|---|---|
![]() |
+31 (15) 251-8111 | |||
![]() |
info@specs.net | |||
| Chemical manufacturer since 1987 | ||||
| Name | 2,3,4,5-Tetrachlorobiphenyl |
|---|---|
| Synonyms | 2,3,4,5-Tetrachloro-1,1'-biphenyl; 2,3,4,5-TETRACHLOROBIPHENYL (PCB-61); biphenyl, 2,3,4,5-tetrachloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl4 |
| Molecular Weight | 291.99 |
| CAS Registry Number | 26914-33-0 |
| SMILES | C1=CC=C(C=C1)C2=CC(=C(C(=C2Cl)Cl)Cl)Cl |
| InChI | 1S/C12H6Cl4/c13-9-6-8(7-4-2-1-3-5-7)10(14)12(16)11(9)15/h1-6H |
| InChIKey | HLQDGCWIOSOMDP-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 362.7±37.0°C at 760 mmHg (Cal.) |
| Flash point | 175.1±23.9°C (Cal.) |
| Refractive index | 1.612 (Cal.) |
| (1) | Igor V. Tetko, Vsevolod Yu. Tanchuk, Tamara N. Kasheva, and Alessandro E. P. Villa. Estimation of Aqueous Solubility of Chemical Compounds Using E-State Indices, J. Chem. Inf. Comput. Sci., 2001, 41 (6), pp 1488–1493 |
|---|---|
| Market Analysis Reports |