| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Alsachim SAS | France | |||
|---|---|---|---|---|
![]() |
+33 (368) 240-080 | |||
![]() |
contact@alsachim.com | |||
| Chemical manufacturer | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| CacheSyn Inc. | Canada | |||
|---|---|---|---|---|
![]() |
+1 (416) 996-8186 | |||
![]() |
info@cachesyn.com | |||
| Chemical manufacturer | ||||
| RIA International LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (973) 581-1282/ | |||
![]() |
marketing@riausa.net,nj@riausa.net | |||
| Chemical distributor | ||||
| Classification | API >> Hormone and endocrine-regulating drugs >> Pancreatic hormones and other blood sugar regulating drugs |
|---|---|
| Name | Glibornuride |
| Synonyms | 1-(3-Hydroxy-4,7,7-Trimethyl-Norbornan-2-Yl)-3-(4-Methylphenyl)Sulfonyl-Urea; 1-(3-Hydroxy-4,7,7-Trimethyl-2-Norbornanyl)-3-(4-Methylphenyl)Sulfonylurea; 1-(6-Hydroxy-1,7,7-Trimethyl-5-Bicyclo[2.2.1]Heptanyl)-3-(4-Methylphenyl)Sulfonyl-Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.47 |
| CAS Registry Number | 26944-48-9 |
| EINECS | 248-124-6 |
| SMILES | C1=CC(=CC=C1[S](NC(NC2C(C3(C(C2CC3)(C)C)C)O)=O)(=O)=O)C |
| InChI | 1S/C18H26N2O4S/c1-11-5-7-12(8-6-11)25(23,24)20-16(22)19-14-13-9-10-18(4,15(14)21)17(13,2)3/h5-8,13-15,21H,9-10H2,1-4H3,(H2,19,20,22) |
| InChIKey | RMTYNAPTNBJHQI-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |