|
CAS#: 26964-29-4 Product: 3,5,7-Trimethoxyflavone No suppilers available for the product. |
| Name | 3,5,7-Trimethoxyflavone |
|---|---|
| Synonyms | 3,5,7-Trimethoxy-2-Phenyl-Chromen-4-One; 3,5,7-Trimethoxy-2-Phenyl-4-Chromenone; 3,5,7-Trimethoxy-2-Phenyl-Chromone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.32 |
| CAS Registry Number | 26964-29-4 |
| SMILES | C2=C1OC(=C(C(C1=C(C=C2OC)OC)=O)OC)C3=CC=CC=C3 |
| InChI | 1S/C18H16O5/c1-20-12-9-13(21-2)15-14(10-12)23-17(18(22-3)16(15)19)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | CBTHKWVPSIGKMI-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 513.126°C at 760 mmHg (Cal.) |
| Flash point | 228.526°C (Cal.) |
| (1) | J. B.-J. Teh, H.-K. Fun, I. A. Razak, N. Boonnak, S. Chantrapromma and C. Karalai. 3,5,7-Trimethoxy-2-phenyl-4H-1-benzopyran-4-one, Acta Cryst. (2005). E61, o3653-o3655 |
|---|---|
| Market Analysis Reports |