|
CAS#: 26982-03-6 Product: Sodium Chlorophenolate No suppilers available for the product. |
| Name | Sodium Chlorophenolate |
|---|---|
| Synonyms | Caswell No. 203A; Epa Pesticide Chemical Code 062205 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4ClNaO |
| Molecular Weight | 150.54 |
| CAS Registry Number | 26982-03-6 (35535-81-0) |
| EINECS | 252-608-2 |
| SMILES | C1=C(Cl)C(=CC=C1)[O-].[Na+] |
| InChI | 1S/C6H5ClO.Na/c7-5-3-1-2-4-6(5)8;/h1-4,8H;/q;+1/p-1 |
| InChIKey | GQFIWFPBDXSASA-UHFFFAOYSA-M |
| Boiling point | 175°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 63.9°C (Cal.) |
| (1) | Thomas C. Rosen, Kristin Kirschbaum and Dean M. Giolando. Homoleptic phenolate complexes of zirconium(iv): syntheses and structural characterization of the first six coordinate complexes, Dalton Trans., 2003, 0, 120. |
|---|---|
| Market Analysis Reports |