| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Sigma-Aldrich, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+86 (21) 6141-5566 / 800-819-3336 | |||
![]() |
ordercn@sial.com, | |||
| Chemical manufacturer since 1992 | ||||
| Classification | Organic raw materials >> Amino compound >> Acyclic monoamines, polyamines and their derivatives and salts |
|---|---|
| Name | N,N,N',N'-Tetrabutyl-1,6-Hexanediamine |
| Synonyms | Dibutyl-[6-(Dibutylamino)Hexyl]Amine; 1,6-Hexanediamine, N,N,N',N'-Tetrabutyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H48N2 |
| Molecular Weight | 340.63 |
| CAS Registry Number | 27090-63-7 |
| EINECS | 248-219-2 |
| SMILES | C(N(CCCC)CCCC)CCCCCN(CCCC)CCCC |
| InChI | 1S/C22H48N2/c1-5-9-17-23(18-10-6-2)21-15-13-14-16-22-24(19-11-7-3)20-12-8-4/h5-22H2,1-4H3 |
| InChIKey | UPPIBFVZIFKMFO-UHFFFAOYSA-N |
| Density | 0.839g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.462°C at 760 mmHg (Cal.) |
| Flash point | 180.88°C (Cal.) |
| (1) | Randhir P. Deo and Rolf U. Halden. In silico screening for unmonitored, potentially problematic high production volume (HPV) chemicals prone to sequestration in biosolids, J. Environ. Monit., 2010, 12, 1840. |
|---|---|
| Market Analysis Reports |