| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 4-Chloro-N-[(4-Chlorophenyl)Sulfonyl]-Benzenesulfonamide |
|---|---|
| Synonyms | 4-Chloro-N-(4-Chlorophenyl)Sulfonyl-Benzenesulfonamide; Nsc68046 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9Cl2NO4S2 |
| Molecular Weight | 366.23 |
| CAS Registry Number | 2725-55-5 |
| SMILES | C2=C([S](N[S](C1=CC=C(Cl)C=C1)(=O)=O)(=O)=O)C=CC(=C2)Cl |
| InChI | 1S/C12H9Cl2NO4S2/c13-9-1-5-11(6-2-9)20(16,17)15-21(18,19)12-7-3-10(14)4-8-12/h1-8,15H |
| InChIKey | ISLGMFCNZJGDTA-UHFFFAOYSA-N |
| Density | 1.568g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.138°C at 760 mmHg (Cal.) |
| Flash point | 268.975°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | P. G. Jones and S. Friedrichs. Secondary interactions in gold(I) complexes with thione ligands. 5. Two ionic compounds of the form bis(thione)gold(I) bis(4-halobenzenesulfonyl)amide, Acta Cryst. (2006). C62, m623-m627 |
|---|---|
| Market Analysis Reports |