|
CAS#: 2729-11-5 Product: 1-Bis(2,3,4,5,6-Pentafluorophenyl)Phosphoryl-2,3,4,5,6-Pentafluorobenzene No suppilers available for the product. |
| Name | 1-Bis(2,3,4,5,6-Pentafluorophenyl)Phosphoryl-2,3,4,5,6-Pentafluorobenzene |
|---|---|
| Synonyms | 1-Bis(2,3,4,5,6-Pentafluorophenyl)Phosphoryl-2,3,4,5,6-Pentafluoro-Benzene; Nsc168732; Phosphine Oxide, Tris(Pentafluorophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C18F15OP |
| Molecular Weight | 548.15 |
| CAS Registry Number | 2729-11-5 |
| SMILES | C1(=C(C(=C(C(=C1F)F)F)F)[P](=O)(C2=C(F)C(=C(C(=C2F)F)F)F)C3=C(F)C(=C(C(=C3F)F)F)F)F |
| InChI | 1S/C18F15OP/c19-1-4(22)10(28)16(11(29)5(1)23)35(34,17-12(30)6(24)2(20)7(25)13(17)31)18-14(32)8(26)3(21)9(27)15(18)33 |
| InChIKey | VDVWCGGZSOUZCE-UHFFFAOYSA-N |
| Density | 1.806g/cm3 (Cal.) |
|---|---|
| Boiling point | 431.624°C at 760 mmHg (Cal.) |
| Flash point | 214.839°C (Cal.) |
| (1) | B. K. Nicholson and S. E. Thwaite. Tris(pentafluorophenyl)phosphine oxide, Acta Cryst. (2003). E59, o1700-o1701 |
|---|---|
| Market Analysis Reports |