|
CAS#: 273-91-6 Product: 1,3-Benzoselenazole No suppilers available for the product. |
| Name | 1,3-Benzoselenazole |
|---|---|
| Synonyms | 1-Selena-3-Azaindene; Inchi=1/C7h5nse/C1-2-4-7-6(3-1)8-5-9-7/H1-5; Benzoselenazole |
| Molecular Structure | ![]() |
| Molecular Formula | C7H5NSe |
| Molecular Weight | 182.08 |
| CAS Registry Number | 273-91-6 |
| SMILES | [Se]1C2=C(N=C1)C=CC=C2 |
| InChI | 1S/C7H5NSe/c1-2-4-7-6(3-1)8-5-9-7/h1-5H |
| InChIKey | AIGNCQCMONAWOL-UHFFFAOYSA-N |
| Boiling point | 253.433°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 107.073°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Paulo F. Santos, Lucinda V. Reis, Paulo Almeida and Daniel E. Lynch. Crystal structures of a benzoselenazole-derived squarylium cyanine dye and three derivatives substituted at the central squaric ring, CrystEngComm, 2011, 13, 1333. |
|---|---|
| Market Analysis Reports |