| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| DSL Chemicals (Shanghai) Co., Ltd. | China | |||
|---|---|---|---|---|
![]() |
+86 (21) 6352-9955 | |||
![]() |
info@dsl-chem.com | |||
| Chemical manufacturer since 1997 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Jupiter Sciences LLC | USA | |||
|---|---|---|---|---|
![]() |
+1 (919) 760-9288 | |||
![]() |
sales@jupiter-sciences.com | |||
| Chemical manufacturer since 2012 | ||||
| King Scientific | USA | |||
|---|---|---|---|---|
![]() |
sales@kingscientific.com | |||
| Chemical manufacturer since 2013 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Matrix Scientific Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (803) 788-9494 | |||
![]() |
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Name | Triisopropylbenzene |
|---|---|
| Synonyms | 1,3,5-Triisopropylbenzene; Benzene, 1,3,5-Triisopropyl-; Nsc403075 |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 27322-34-5 |
| EINECS | 248-404-8 |
| SMILES | C1=C(C=C(C(C)C)C=C1C(C)C)C(C)C |
| InChI | 1S/C15H24/c1-10(2)13-7-14(11(3)4)9-15(8-13)12(5)6/h7-12H,1-6H3 |
| InChIKey | VUMCUSHVMYIRMB-UHFFFAOYSA-N |
| Density | 0.9±0.1g/cm3 (Cal.) |
|---|---|
| 0.854 (Expl.) | |
| Melting point | -7°C (Expl.) |
| Boiling point | 235-237°C (Expl.) |
| 238.6±20.0°C at 760 mmHg (Cal.) | |
| Flash point | 86.667°C (Cal.) |
| 86°C (Expl.) | |
| Refractive index | 1.488 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| (1) | Manik Mandal and Michal Kruk. Versatile approach to synthesis of 2-D hexagonal ultra-large-pore periodic mesoporous organosilicas, J. Mater. Chem., 2010, 20, 7506. |
|---|---|
| Market Analysis Reports |