| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Interchim Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (800) 560-8262 | |||
![]() |
web@interchiminc.com | |||
| Chemical manufacturer | ||||
| Name | 9,10-Dioxo-9,10-Dihydro-2,3-Anthracenedicarboxylic Acid |
|---|---|
| Synonyms | 9,10-Dihydro-9,10-dioxo-2,3-anthracenedicarboxylic acid; Anthraquinone-2,3-dicarboxylic Acid; ANTHRAQUINONE-2,3-DICARBOXYLICACID |
| Molecular Structure | ![]() |
| Molecular Formula | C16H8O6 |
| Molecular Weight | 296.23 |
| CAS Registry Number | 27485-15-0 |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC(=C(C=C3C2=O)C(=O)O)C(=O)O |
| InChI | 1S/C16H8O6/c17-13-7-3-1-2-4-8(7)14(18)10-6-12(16(21)22)11(15(19)20)5-9(10)13/h1-6H,(H,19,20)(H,21,22) |
| InChIKey | PSHVQIKBLXBIQJ-UHFFFAOYSA-N |
| Density | 1.6±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 627.0±55.0°C at 760 mmHg (Cal.) |
| Flash point | 347.0±28.0°C (Cal.) |
| Refractive index | 1.717 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Joshua D. Furman, Ryan P. Burwood, Min Tang, Alexander A. Mikhailovsky and Anthony K. Cheetham. Understanding ligand-centred photoluminescence through flexibility and bonding of anthraquinone inorganic–organic frameworks, J. Mater. Chem., 2011, 21, 6595. |
|---|---|
| Market Analysis Reports |