|
CAS#: 27518-97-4 Product: Amicetose No suppilers available for the product. |
| Name | Amicetose |
|---|---|
| Synonyms | 2,3,6-Trideoxy-D-Erythro-Hexose; Amicetose; Chebi:30941 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 |
| CAS Registry Number | 27518-97-4 |
| SMILES | [C@H](CCC=O)([C@@H](C)O)O |
| InChI | 1S/C6H12O3/c1-5(8)6(9)3-2-4-7/h4-6,8-9H,2-3H2,1H3/t5-,6+/m1/s1 |
| InChIKey | XXIHHRIZGBRENI-RITPCOANSA-N |
| Density | 1.095g/cm3 (Cal.) |
|---|---|
| Boiling point | 288.976°C at 760 mmHg (Cal.) |
| Flash point | 142.804°C (Cal.) |
| (1) | María Pérez, Felipe Lombó, Lili Zhu, Miranda Gibson, Alfredo F. Braña, Jürgen Rohr, José A. Salas and Carmen Méndez. Combining sugar biosynthesis genes for the generation of l- and d-amicetose and formation of two novel antitumor tetracenomycins, Chem. Commun., 2005, 0, 1604. |
|---|---|
| Market Analysis Reports |