| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Hexanedioic Acid 1,6-Bis(2-Oxiranylmethyl) Ester |
|---|---|
| Synonyms | Hexanedioic Acid Bis(2-Oxiranylmethyl) Ester; Adipic Acid Diglycidyl Ester; Bis(2,3-Epoxypropyl) Adipate |
| Molecular Structure | ![]() |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 |
| CAS Registry Number | 2754-17-8 |
| EINECS | 220-403-7 |
| SMILES | C(C1OC1)OC(=O)CCCCC(=O)OCC2OC2 |
| InChI | 1S/C12H18O6/c13-11(17-7-9-5-15-9)3-1-2-4-12(14)18-8-10-6-16-10/h9-10H,1-8H2 |
| InChIKey | KBWLNCUTNDKMPN-UHFFFAOYSA-N |
| Density | 1.241g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.212°C at 760 mmHg (Cal.) |
| Flash point | 164.311°C (Cal.) |
| (1) | Shuo LiElectronic supplementary information (ESI) available: Characterization of 2 and 3. See DOI: 10.1039/c0mb00339e, Yu Wang, Ji Zhang, Wei-Han Yang, Zhen-Hua Dai, Wen Zhu and Xiao-Qi Yu. Biodegradable cross-linked poly(amino alcohol esters) based on LMW PEI for gene delivery, Mol. Biosyst., 2011, 7, 1254. |
|---|---|
| Market Analysis Reports |