| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-(Pyridine-2-Carbonyl)Benzoic Acid |
|---|---|
| Synonyms | 2-[Oxo-(2-Pyridyl)Methyl]Benzoic Acid; 2-Pyridin-2-Ylcarbonylbenzoic Acid; Nsc320001 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.22 |
| CAS Registry Number | 27693-49-8 |
| SMILES | C1=CC=CC(=C1C(C2=NC=CC=C2)=O)C(O)=O |
| InChI | 1S/C13H9NO3/c15-12(11-7-3-4-8-14-11)9-5-1-2-6-10(9)13(16)17/h1-8H,(H,16,17) |
| InChIKey | WTUKXPYMQWVXOB-UHFFFAOYSA-N |
| Density | 1.311g/cm3 (Cal.) |
|---|---|
| Boiling point | 465.412°C at 760 mmHg (Cal.) |
| Flash point | 235.273°C (Cal.) |
| (1) | Anne-Sophie Rebstock, Florence Mongin, François Trécourt and Guy Quéguiner. Metallation of pyridines and quinolines in the presence of a remote carboxylate group. New syntheses of heterocyclic quinones, Org. Biomol. Chem., 2004, 2, 291. |
|---|---|
| Market Analysis Reports |