| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| Ryan Scientific, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (843)-884-4911 | |||
![]() |
sales@ryansci.com | |||
| Chemical manufacturer | ||||
| Name | 3,4-Methylenedioxybenzylidene Aniline |
|---|---|
| Synonyms | 1-(1,3-Benzodioxol-5-Yl)-N-Phenyl-Methanimine; 1,3-Benzodioxol-5-Ylmethylene-Phenyl-Amine; Zinc00575411 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 |
| CAS Registry Number | 27738-39-2 |
| SMILES | C1=C(C=CC=C1)N=CC2=CC3=C(C=C2)OCO3 |
| InChI | 1S/C14H11NO2/c1-2-4-12(5-3-1)15-9-11-6-7-13-14(8-11)17-10-16-13/h1-9H,10H2 |
| InChIKey | OCPBTGFXVLONGM-UHFFFAOYSA-N |
| Density | 1.185g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.537°C at 760 mmHg (Cal.) |
| Flash point | 141.06°C (Cal.) |
| SDS | Available |
|---|---|
| (1) | Guzen K P, Guarezemini A S, Órfão A T G, Cella R, Pereira C M P, and Stefani H A. Eco-friendly synthesis of imines by ultrasound irradiation, Tetrahedron Letters, 2007, 48, 1845-1848 |
|---|---|
| Market Analysis Reports |