| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | (3E)-5-Methyl-1,3-Hexadiene |
|---|---|
| Synonyms | InChI=1/C7H12/c1-4-5-6-7(2)3/h4-7H,1H2,2-3H3; ghl.PDMitscherleg0.1227 |
| Molecular Structure | ![]() |
| Molecular Formula | C7H12 |
| Molecular Weight | 96.17 |
| CAS Registry Number | 2783-10-0 |
| SMILES | CC(C)/C=C/C=C |
| InChI | 1S/C7H12/c1-4-5-6-7(2)3/h4-7H,1H2,2-3H3/b6-5+ |
| InChIKey | HQLSCIPCIFAMOK-AATRIKPKSA-N |
| Density | 0.7±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 95.0±7.0°C at 760 mmHg (Cal.) |
| Flash point | -2.9±13.0°C (Cal.) |
| Refractive index | 1.427 (Cal.) |
| (1) | Alison G. Lewin, David Johnson, David W. Price and George Marston. Aspects of the kinetics and mechanism of the gas-phase reactions of ozone with conjugated dienes, Phys. Chem. Chem. Phys., 2001, 3, 1253. |
|---|---|
| Market Analysis Reports |