| Otava Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 522-2458 | |||
![]() |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 3,6-Dimethyl-1,2-Benzenediol |
|---|---|
| Synonyms | InChI=1/C8H10O2/c1-5-3-4-6(2)8(10)7(5)9/h3-4,9-10H,1-2H3 |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.16 |
| CAS Registry Number | 2785-78-6 |
| SMILES | CC1=C(C(=C(C=C1)C)O)O |
| InChI | 1S/C8H10O2/c1-5-3-4-6(2)8(10)7(5)9/h3-4,9-10H,1-2H3 |
| InChIKey | RGUZWBOJHNWZOK-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 251.0±35.0°C at 760 mmHg (Cal.) |
| Flash point | 119.9±20.5°C (Cal.) |
| Refractive index | 1.582 (Cal.) |
| SDS | Available |
|---|---|
| (1) | Geoffrey C. Eastmond, Jerzy Paprotny, Alexander Steiner and Linda Swanson. Synthesis of cyanodibenzo[1,4]dioxines and their derivatives by cyano-activated fluoro displacement reactions, New J. Chem., 2001, 25, 379. |
|---|---|
| Market Analysis Reports |