| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Enamine Ltd. | Ukraine | |||
|---|---|---|---|---|
![]() |
+380 (44) 537-3218 | |||
![]() |
enamine@enamine.net | |||
| Chemical manufacturer since 1991 | ||||
| Fluorochem Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (1457) 860-111 | |||
![]() |
enquiries@fluorochem.co.uk | |||
| Chemical manufacturer | ||||
| Frinton Laboratories, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (856) 722-7037 | |||
![]() |
frinton@frinton.com | |||
| Chemical manufacturer | ||||
| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | |||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Zylexa Pharma Ltd. | UK | |||
|---|---|---|---|---|
![]() |
+44 (845) 299-6009/ | |||
![]() |
sales@zylexa-pharma.com,enquiries@zylexa-pharma.com | |||
| Chemical manufacturer | ||||
| Name | 4-Heptyloxybenzaldehyde |
|---|---|
| Synonyms | 4-Heptyloxybenzaldehyde; Benzaldehyde, 4-(Heptyloxy)- |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 27893-41-0 |
| EINECS | 248-714-3 |
| SMILES | C1=C(OCCCCCCC)C=CC(=C1)C=O |
| InChI | 1S/C14H20O2/c1-2-3-4-5-6-11-16-14-9-7-13(12-15)8-10-14/h7-10,12H,2-6,11H2,1H3 |
| InChIKey | YBCKMIZXHKVONZ-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| 0.99 (Expl.) | |
| Boiling point | 152-154°C (Expl.) |
| 334.7±15.0°C at 760 mmHg (Cal.) | |
| Flash point | 138.6±13.9°C (Cal.) |
| Refractive index | 1.525 (Expl.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |