| Abacipharm Corporation | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 417-5545 | |||
![]() |
sales@abacipharm.com | |||
| Chemical manufacturer | ||||
| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Alfa Aesar. | USA | |||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| ChemPacific Corp | USA | |||
|---|---|---|---|---|
![]() |
+1 (410) 633-5771 | |||
![]() |
sales@chempacific.com | |||
| Chemical manufacturer since 1995 | ||||
| HDH Pharma, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (858) 451-2028 | |||
![]() |
catalog@hdhpharma.com | |||
| Chemical manufacturer since 2008 | ||||
| King Scientific | USA | |||
|---|---|---|---|---|
![]() |
sales@kingscientific.com | |||
| Chemical manufacturer since 2013 | ||||
| MP Biomedicals LLC. | USA | |||
|---|---|---|---|---|
![]() |
+1 (440) 337-1200 | |||
![]() |
info@mpbio.com | |||
| Chemical manufacturer | ||||
| Merck Millipore | USA | |||
|---|---|---|---|---|
![]() |
+86 (10) 5989-8600 | |||
![]() |
asiatechserv@millipore.com | |||
| Chemical manufacturer since 1954 | ||||
| Paragos e. K. | Germany | |||
|---|---|---|---|---|
![]() |
+49 2330-8079751 | |||
![]() |
sales@paragos.de | |||
| Chemical manufacturer since 2001 | ||||
| Santa Cruz Biotechnology, Inc. | USA | |||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Name | Dichloronitro-Benzene |
|---|---|
| Synonyms | 1,2-Dichloro-3-Nitro-Benzene; Zinc01690400; Ncgc00091860-01 |
| Molecular Formula | C6H3Cl2NO2 |
| Molecular Weight | 192.00 |
| CAS Registry Number | 27900-75-0 |
| SMILES | C1=C([N+]([O-])=O)C(=C(Cl)C=C1)Cl |
| InChI | 1S/C6H3Cl2NO2/c7-4-2-1-3-5(6(4)8)9(10)11/h1-3H |
| InChIKey | CMVQZRLQEOAYSW-UHFFFAOYSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| 1.45 (Expl.) | |
| Melting point | 62°C (Expl.) |
| Boiling point | 257-258°C (Expl.) |
| 257.499°C at 760 mmHg (Cal.) | |
| Flash point | 123°C (Expl.) |
| 123.889°C (Cal.) | |
| Safety Code | S36;S61 Details |
|---|---|
| Risk Code | R22;R33;R51/53 Details |
| Hazard Symbol | X;N Details |
| Transport Information | UN3077 |
| Safety Description | WARNING: Irritates skin and eyes, harmful if swallowed |
| DANGER: POISON, irritates skin, eyes, lungs | |
| (1) | Sarah L. Price. From crystal structure prediction to polymorph prediction: interpreting the crystal energy landscape, Phys. Chem. Chem. Phys., 2008, 10, 1996. |
|---|---|
| Market Analysis Reports |