| Biosynth AG. | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (71) 858-2020 | |||
![]() |
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Glentham Life Sciences | UK | |||
|---|---|---|---|---|
![]() |
+44 (2033) 978-798 | |||
![]() |
info@glenthamls.com | |||
| Chemical distributor since 2013 | ||||
| Name | (2R,3S,4S)-2-(4-Methoxybenzyl)-3,4-Pyrrolidinediol |
|---|---|
| Synonyms | (2R,3S,4S)-(-)-2-(P-METHOXYBENZYL)-3,4-PYRROLIDINEDIOL |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 |
| CAS Registry Number | 27958-06-1 |
| SMILES | COC1=CC=C(C=C1)C[C@@H]2[C@@H]([C@H](CN2)O)O |
| InChI | 1S/C12H17NO3/c1-16-9-4-2-8(3-5-9)6-10-12(15)11(14)7-13-10/h2-5,10-15H,6-7H2,1H3/t10-,11+,12+/m1/s1 |
| InChIKey | UMWAPBCLJQSOJX-WOPDTQHZSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.7±37.0°C at 760 mmHg (Cal.) |
| Flash point | 190.1±26.5°C (Cal.) |
| Refractive index | 1.587 (Cal.) |
| (1) | Jing Zeng, Qian Zhang, Hong-Kui Zhang and Anqi Chen. Practical synthesis of trans-dihydroxybutyrolactols as chiral C building blocks and their application to the synthesis of polyhydroxylated alkaloids, RSC Advances, 2013, . |
|---|---|
| Market Analysis Reports |