| Alfa Chemistry | USA | |||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | |||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Bicyclo[2.2.2]Octane |
|---|---|
| Synonyms | Inchi=1/C8h14/C1-2-8-5-3-7(1)4-6-8/H7-8H,1-6H; 1,4-Endoethylenecyclohexane; Bicyclo(2.2.2)Octane |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14 |
| Molecular Weight | 110.20 |
| CAS Registry Number | 280-33-1 |
| SMILES | C1C2CCC(C1)CC2 |
| InChI | 1S/C8H14/c1-2-8-5-3-7(1)4-6-8/h7-8H,1-6H2 |
| InChIKey | GPRLTFBKWDERLU-UHFFFAOYSA-N |
| Density | 0.896g/cm3 (Cal.) |
|---|---|
| Boiling point | 140.504°C at 760 mmHg (Cal.) |
| Flash point | 19.445°C (Cal.) |
| (1) | Kerrie A. B. Austin, Jon D. Elsworth, Martin G. Banwell and Anthony C. Willis. Chemoenzymatic and enantiodivergent routes to 1,2-ring-fused bicyclo[2.2.2]octane and related tricyclic frameworks, Org. Biomol. Chem., 2010, 8, 751. |
|---|---|
| Market Analysis Reports |