| Achemica | Switzerland | |||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| Name | 5-Phenoxyisophthalic Acid |
|---|---|
| Synonyms | 5-(Phenoxy)Isophthalic Acid; 1,3-Benzenedicarboxylic Acid, 5-Phenoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O5 |
| Molecular Weight | 258.23 |
| CAS Registry Number | 28023-55-4 |
| SMILES | C1=CC=C(C=C1)OC2=CC(=CC(=C2)C(=O)O)C(=O)O |
| InChI | 1S/C14H10O5/c15-13(16)9-6-10(14(17)18)8-12(7-9)19-11-4-2-1-3-5-11/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | ZZMSWJDUUZUBNA-UHFFFAOYSA-N |
| Density | 1.395g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.797°C at 760 mmHg (Cal.) |
| Flash point | 190.457°C (Cal.) |
| (1) | In-Yup Jeon, Hyun-Jung Choi, Seo-Yoon Bae, Dong Wook Chang and Jong-Beom Baek. Wedging graphite into graphene and graphene-like platelets by dendritic macromolecules, J. Mater. Chem., 2011, 21, 7820. |
|---|---|
| Market Analysis Reports |